C27H22F3N3O8S — CID 159101927
3-amino-2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-(4-methoxyphenyl)sulfonylbenzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 159101927) has the molecular formula C27H22F3N3O8S and a molecular weight of 605.55 g/mol. Its IUPAC name is 3-amino-2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-(4-methoxyphenyl)sulfonylbenzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-amino-2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-(4-methoxyphenyl)sulfonylbenzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159101927 |
| Molecular Formula | C27H22F3N3O8S |
| Molecular Weight | 605.55 g/mol |
| Exact Mass | 605.11 |
| IUPAC Name | 3-amino-2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-(4-methoxyphenyl)sulfonylbenzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc2cc(Oc3c(N)cc(S(=O)(=O)c4ccc(OC)cc4)cc3C(=O)O)ccc2c1 |
| InChI | InChI=1S/C25H21N3O6S.C2HF3O2/c1-33-17-6-8-19(9-7-17)35(31,32)20-12-21(25(29)30)23(22(26)13-20)34-18-5-4-14-10-16(24(27)28)3-2-15(14)11-18;3-2(4,5)1(6)7/h2-13H,26H2,1H3,(H3,27,28)(H,29,30);(H,6,7) |
| InChIKey | GCSZRQMHBVUMQT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 203.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|