C17H14F3N3O4S — CID 74763901
7-methoxy-8-(1,3-thiazol-2-yloxy)naphthalene-2-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 74763901) has the molecular formula C17H14F3N3O4S and a molecular weight of 413.38 g/mol. Its IUPAC name is 7-methoxy-8-(1,3-thiazol-2-yloxy)naphthalene-2-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 7-methoxy-8-(1,3-thiazol-2-yloxy)naphthalene-2-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 74763901 |
| Molecular Formula | C17H14F3N3O4S |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 7-methoxy-8-(1,3-thiazol-2-yloxy)naphthalene-2-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc2ccc(OC)c(Oc3nccs3)c2c1 |
| InChI | InChI=1S/C15H13N3O2S.C2HF3O2/c1-19-12-5-4-9-2-3-10(14(16)17)8-11(9)13(12)20-15-18-6-7-21-15;3-2(4,5)1(6)7/h2-8H,1H3,(H3,16,17);(H,6,7) |
| InChIKey | JHYXIKFWVRTVJQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|