C20H20F4N4O6S — CID 161373997
(4-carbamimidoyl-2-fluorophenyl) 2-(4-methoxycarbonylpiperidin-1-yl)-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 161373997) has the molecular formula C20H20F4N4O6S and a molecular weight of 520.46 g/mol. Its IUPAC name is (4-carbamimidoyl-2-fluorophenyl) 2-(4-methoxycarbonylpiperidin-1-yl)-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | (4-carbamimidoyl-2-fluorophenyl) 2-(4-methoxycarbonylpiperidin-1-yl)-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161373997 |
| Molecular Formula | C20H20F4N4O6S |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | (4-carbamimidoyl-2-fluorophenyl) 2-(4-methoxycarbonylpiperidin-1-yl)-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(OC(=O)c2cnc(N3CCC(C(=O)OC)CC3)s2)c(F)c1 |
| InChI | InChI=1S/C18H19FN4O4S.C2HF3O2/c1-26-16(24)10-4-6-23(7-5-10)18-22-9-14(28-18)17(25)27-13-3-2-11(15(20)21)8-12(13)19;3-2(4,5)1(6)7/h2-3,8-10H,4-7H2,1H3,(H3,20,21);(H,6,7) |
| InChIKey | QCXGNPAXJXWNFF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 155.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|