C18H19N3O5S — CID 146242125
(4-carbamoylphenyl) 2-(4-methoxycarbonylpiperidin-1-yl)-1,3-thiazole-5-carboxylate (PubChem CID 146242125) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is (4-carbamoylphenyl) 2-(4-methoxycarbonylpiperidin-1-yl)-1,3-thiazole-5-carboxylate.
| Compound Name | (4-carbamoylphenyl) 2-(4-methoxycarbonylpiperidin-1-yl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 146242125 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (4-carbamoylphenyl) 2-(4-methoxycarbonylpiperidin-1-yl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)C1CCN(c2ncc(C(=O)Oc3ccc(C(N)=O)cc3)s2)CC1 |
| InChI | InChI=1S/C18H19N3O5S/c1-25-16(23)12-6-8-21(9-7-12)18-20-10-14(27-18)17(24)26-13-4-2-11(3-5-13)15(19)22/h2-5,10,12H,6-9H2,1H3,(H2,19,22) |
| InChIKey | LOXVHYNACAEZAQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|