C21H25N5O5S — CID 155681211
(4-carbamimidoylphenyl) 2-[4-[(3-methoxy-3-oxopropyl)carbamoyl]piperidin-1-yl]-1,3-thiazole-5-carboxylate (PubChem CID 155681211) has the molecular formula C21H25N5O5S and a molecular weight of 459.53 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) 2-[4-[(3-methoxy-3-oxopropyl)carbamoyl]piperidin-1-yl]-1,3-thiazole-5-carboxylate.
| Compound Name | (4-carbamimidoylphenyl) 2-[4-[(3-methoxy-3-oxopropyl)carbamoyl]piperidin-1-yl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 155681211 |
| Molecular Formula | C21H25N5O5S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (4-carbamimidoylphenyl) 2-[4-[(3-methoxy-3-oxopropyl)carbamoyl]piperidin-1-yl]-1,3-thiazole-5-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2cnc(N3CCC(C(=O)NCCC(=O)OC)CC3)s2)cc1 |
| InChI | InChI=1S/C21H25N5O5S/c1-30-17(27)6-9-24-19(28)14-7-10-26(11-8-14)21-25-12-16(32-21)20(29)31-15-4-2-13(3-5-15)18(22)23/h2-5,12,14H,6-11H2,1H3,(H3,22,23)(H,24,28) |
| InChIKey | OVRYEIBSHZNFCZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 147.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|