C21H20N4O4S — CID 155681206
1-[6-(4-carbamimidoylphenoxy)carbonyl-1,3-benzothiazol-2-yl]piperidine-4-carboxylic acid (PubChem CID 155681206) has the molecular formula C21H20N4O4S and a molecular weight of 424.48 g/mol. Its IUPAC name is 1-[6-(4-carbamimidoylphenoxy)carbonyl-1,3-benzothiazol-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-(4-carbamimidoylphenoxy)carbonyl-1,3-benzothiazol-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 155681206 |
| Molecular Formula | C21H20N4O4S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-[6-(4-carbamimidoylphenoxy)carbonyl-1,3-benzothiazol-2-yl]piperidine-4-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc3nc(N4CCC(C(=O)O)CC4)sc3c2)cc1 |
| InChI | InChI=1S/C21H20N4O4S/c22-18(23)12-1-4-15(5-2-12)29-20(28)14-3-6-16-17(11-14)30-21(24-16)25-9-7-13(8-10-25)19(26)27/h1-6,11,13H,7-10H2,(H3,22,23)(H,26,27) |
| InChIKey | KEPRJUGYSFELJA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|