C26H22FN3O3S — CID 153407327
(2-fluorophenyl) 2-(4-benzamidopiperidin-1-yl)-1,3-benzothiazole-6-carboxylate (PubChem CID 153407327) has the molecular formula C26H22FN3O3S and a molecular weight of 475.55 g/mol. Its IUPAC name is (2-fluorophenyl) 2-(4-benzamidopiperidin-1-yl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | (2-fluorophenyl) 2-(4-benzamidopiperidin-1-yl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 153407327 |
| Molecular Formula | C26H22FN3O3S |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | (2-fluorophenyl) 2-(4-benzamidopiperidin-1-yl)-1,3-benzothiazole-6-carboxylate |
| SMILES | O=C(NC1CCN(c2nc3ccc(C(=O)Oc4ccccc4F)cc3s2)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H22FN3O3S/c27-20-8-4-5-9-22(20)33-25(32)18-10-11-21-23(16-18)34-26(29-21)30-14-12-19(13-15-30)28-24(31)17-6-2-1-3-7-17/h1-11,16,19H,12-15H2,(H,28,31) |
| InChIKey | SCVVFZJANWWVNW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|