C24H20N2O2S — CID 16873917
(2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl) 4-phenylbenzoate (PubChem CID 16873917) has the molecular formula C24H20N2O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is (2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl) 4-phenylbenzoate.
| Compound Name | (2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl) 4-phenylbenzoate |
|---|---|
| PubChem CID | 16873917 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl) 4-phenylbenzoate |
| SMILES | O=C(Oc1ccc2nc(N3CCCC3)sc2c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N2O2S/c27-23(19-10-8-18(9-11-19)17-6-2-1-3-7-17)28-20-12-13-21-22(16-20)29-24(25-21)26-14-4-5-15-26/h1-3,6-13,16H,4-5,14-15H2 |
| InChIKey | PUTPYUZKEQYEPY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|