C20H18N2O3S — CID 8611178
(2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl) 4-acetylbenzoate (PubChem CID 8611178) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is (2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl) 4-acetylbenzoate.
| Compound Name | (2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl) 4-acetylbenzoate |
|---|---|
| PubChem CID | 8611178 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl) 4-acetylbenzoate |
| SMILES | CC(=O)c1ccc(C(=O)Oc2ccc3nc(N4CCCC4)sc3c2)cc1 |
| InChI | InChI=1S/C20H18N2O3S/c1-13(23)14-4-6-15(7-5-14)19(24)25-16-8-9-17-18(12-16)26-20(21-17)22-10-2-3-11-22/h4-9,12H,2-3,10-11H2,1H3 |
| InChIKey | LNCCQPXRMTVDLK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|