C26H25N3O2S — CID 16874090
[2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-benzylbenzoate (PubChem CID 16874090) has the molecular formula C26H25N3O2S and a molecular weight of 443.57 g/mol. Its IUPAC name is [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-benzylbenzoate.
| Compound Name | [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-benzylbenzoate |
|---|---|
| PubChem CID | 16874090 |
| Molecular Formula | C26H25N3O2S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-benzylbenzoate |
| SMILES | CN1CCN(c2nc3ccc(OC(=O)c4ccc(Cc5ccccc5)cc4)cc3s2)CC1 |
| InChI | InChI=1S/C26H25N3O2S/c1-28-13-15-29(16-14-28)26-27-23-12-11-22(18-24(23)32-26)31-25(30)21-9-7-20(8-10-21)17-19-5-3-2-4-6-19/h2-12,18H,13-17H2,1H3 |
| InChIKey | DDEQUUMBUBAJQD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|