C18H28Cl2N4O3 — CID 19391280
methyl 4-[[1-(4-carbamimidoylphenyl)piperidine-4-carbonyl]amino]butanoate;dihydrochloride (PubChem CID 19391280) has the molecular formula C18H28Cl2N4O3 and a molecular weight of 419.35 g/mol. Its IUPAC name is methyl 4-[[1-(4-carbamimidoylphenyl)piperidine-4-carbonyl]amino]butanoate;dihydrochloride.
| Compound Name | methyl 4-[[1-(4-carbamimidoylphenyl)piperidine-4-carbonyl]amino]butanoate;dihydrochloride |
|---|---|
| PubChem CID | 19391280 |
| Molecular Formula | C18H28Cl2N4O3 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | methyl 4-[[1-(4-carbamimidoylphenyl)piperidine-4-carbonyl]amino]butanoate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(N2CCC(C(=O)NCCCC(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C18H26N4O3.2ClH/c1-25-16(23)3-2-10-21-18(24)14-8-11-22(12-9-14)15-6-4-13(5-7-15)17(19)20;;/h4-7,14H,2-3,8-12H2,1H3,(H3,19,20)(H,21,24);2*1H |
| InChIKey | RWGPQYOUSFEHAR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|