C18H19N3O4S — CID 121352993
(2R)-1-[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 121352993) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is (2R)-1-[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 121352993 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (2R)-1-[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CN3CCC[C@@H]3C(=O)O)s2)cc1 |
| InChI | InChI=1S/C18H19N3O4S/c19-16(20)11-3-5-12(6-4-11)25-18(24)15-8-7-13(26-15)10-21-9-1-2-14(21)17(22)23/h3-8,14H,1-2,9-10H2,(H3,19,20)(H,22,23)/t14-/m1/s1 |
| InChIKey | OLKNNDZDXSKNHR-CQSZACIVSA-N |
| XLogP | 2.30 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|