C18H18ClNO3S — CID 51547671
(2S)-1-[[5-(4-chlorobenzoyl)thiophen-2-yl]methyl]piperidine-2-carboxylic acid (PubChem CID 51547671) has the molecular formula C18H18ClNO3S and a molecular weight of 363.87 g/mol. Its IUPAC name is (2S)-1-[[5-(4-chlorobenzoyl)thiophen-2-yl]methyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[5-(4-chlorobenzoyl)thiophen-2-yl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 51547671 |
| Molecular Formula | C18H18ClNO3S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | (2S)-1-[[5-(4-chlorobenzoyl)thiophen-2-yl]methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc(CN2CCCC[C@H]2C(=O)O)s1 |
| InChI | InChI=1S/C18H18ClNO3S/c19-13-6-4-12(5-7-13)17(21)16-9-8-14(24-16)11-20-10-2-1-3-15(20)18(22)23/h4-9,15H,1-3,10-11H2,(H,22,23)/t15-/m0/s1 |
| InChIKey | QSPKNFZKALNKIT-HNNXBMFYSA-N |
| XLogP | 4.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |