C14H15ClN4O2 — CID 119914161
(2R)-1-[[1-(4-chlorophenyl)triazol-4-yl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 119914161) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is (2R)-1-[[1-(4-chlorophenyl)triazol-4-yl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[[1-(4-chlorophenyl)triazol-4-yl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119914161 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (2R)-1-[[1-(4-chlorophenyl)triazol-4-yl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1Cc1cn(-c2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C14H15ClN4O2/c15-10-3-5-12(6-4-10)19-9-11(16-17-19)8-18-7-1-2-13(18)14(20)21/h3-6,9,13H,1-2,7-8H2,(H,20,21)/t13-/m1/s1 |
| InChIKey | NJRUCPAXJROXOQ-CYBMUJFWSA-N |
| XLogP | 1.97 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |