C14H14ClFN4O2 — CID 122038433
(2R)-1-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 122038433) has the molecular formula C14H14ClFN4O2 and a molecular weight of 324.74 g/mol. Its IUPAC name is (2R)-1-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122038433 |
| Molecular Formula | C14H14ClFN4O2 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (2R)-1-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1Cc1cn(-c2ccc(F)c(Cl)c2)nn1 |
| InChI | InChI=1S/C14H14ClFN4O2/c15-11-6-10(3-4-12(11)16)20-8-9(17-18-20)7-19-5-1-2-13(19)14(21)22/h3-4,6,8,13H,1-2,5,7H2,(H,21,22)/t13-/m1/s1 |
| InChIKey | GKNJPIQOHXMUFC-CYBMUJFWSA-N |
| XLogP | 2.11 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |