C14H12ClFN4O2 — CID 97350153
(3R)-1-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 97350153) has the molecular formula C14H12ClFN4O2 and a molecular weight of 322.73 g/mol. Its IUPAC name is (3R)-1-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | (3R)-1-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 97350153 |
| Molecular Formula | C14H12ClFN4O2 |
| Molecular Weight | 322.73 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | (3R)-1-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | C[C@@H]1CC(=O)N(Cc2cn(-c3ccc(F)c(Cl)c3)nn2)C1=O |
| InChI | InChI=1S/C14H12ClFN4O2/c1-8-4-13(21)19(14(8)22)6-9-7-20(18-17-9)10-2-3-12(16)11(15)5-10/h2-3,5,7-8H,4,6H2,1H3/t8-/m1/s1 |
| InChIKey | YPMAUMIEXBHBOY-MRVPVSSYSA-N |
| XLogP | 1.95 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|