C24H29N3O7S — CID 157354758
(2S)-2-[(3S)-3-[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl-methylamino]-4-methyl-2-oxopentyl]butanedioic acid (PubChem CID 157354758) has the molecular formula C24H29N3O7S and a molecular weight of 503.58 g/mol. Its IUPAC name is (2S)-2-[(3S)-3-[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl-methylamino]-4-methyl-2-oxopentyl]butanedioic acid.
| Compound Name | (2S)-2-[(3S)-3-[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl-methylamino]-4-methyl-2-oxopentyl]butanedioic acid |
|---|---|
| PubChem CID | 157354758 |
| Molecular Formula | C24H29N3O7S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | (2S)-2-[(3S)-3-[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl-methylamino]-4-methyl-2-oxopentyl]butanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CN(C)[C@H](C(=O)C[C@@H](CC(=O)O)C(=O)O)C(C)C)s2)cc1 |
| InChI | InChI=1S/C24H29N3O7S/c1-13(2)21(18(28)10-15(23(31)32)11-20(29)30)27(3)12-17-8-9-19(35-17)24(33)34-16-6-4-14(5-7-16)22(25)26/h4-9,13,15,21H,10-12H2,1-3H3,(H3,25,26)(H,29,30)(H,31,32)/t15-,21-/m0/s1 |
| InChIKey | BHYJNXAGYGYGNB-BTYIYWSLSA-N |
| XLogP | 2.84 |
| TPSA | 171.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|