C29H31N3O7S — CID 157051998
(2R)-2-[(3S)-3-[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl-methylamino]-2-oxo-4-phenylbutyl]pentanedioic acid (PubChem CID 157051998) has the molecular formula C29H31N3O7S and a molecular weight of 565.65 g/mol. Its IUPAC name is (2R)-2-[(3S)-3-[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl-methylamino]-2-oxo-4-phenylbutyl]pentanedioic acid.
| Compound Name | (2R)-2-[(3S)-3-[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl-methylamino]-2-oxo-4-phenylbutyl]pentanedioic acid |
|---|---|
| PubChem CID | 157051998 |
| Molecular Formula | C29H31N3O7S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | (2R)-2-[(3S)-3-[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl-methylamino]-2-oxo-4-phenylbutyl]pentanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CN(C)[C@@H](Cc3ccccc3)C(=O)C[C@@H](CCC(=O)O)C(=O)O)s2)cc1 |
| InChI | InChI=1S/C29H31N3O7S/c1-32(17-22-12-13-25(40-22)29(38)39-21-10-7-19(8-11-21)27(30)31)23(15-18-5-3-2-4-6-18)24(33)16-20(28(36)37)9-14-26(34)35/h2-8,10-13,20,23H,9,14-17H2,1H3,(H3,30,31)(H,34,35)(H,36,37)/t20-,23+/m1/s1 |
| InChIKey | AAHVFVGWVIBPES-OFNKIYASSA-N |
| XLogP | 3.82 |
| TPSA | 171.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|