C25H30N4O6 — CID 54183570
(3S)-3-amino-4-[5-(4-carbamimidoylphenyl)pentanoyl-[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid (PubChem CID 54183570) has the molecular formula C25H30N4O6 and a molecular weight of 482.54 g/mol. Its IUPAC name is (3S)-3-amino-4-[5-(4-carbamimidoylphenyl)pentanoyl-[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[5-(4-carbamimidoylphenyl)pentanoyl-[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54183570 |
| Molecular Formula | C25H30N4O6 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (3S)-3-amino-4-[5-(4-carbamimidoylphenyl)pentanoyl-[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCCCC(=O)N(C(=O)[C@@H](N)CC(=O)O)[C@@H](Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C25H30N4O6/c26-19(15-22(31)32)24(33)29(20(25(34)35)14-17-7-2-1-3-8-17)21(30)9-5-4-6-16-10-12-18(13-11-16)23(27)28/h1-3,7-8,10-13,19-20H,4-6,9,14-15,26H2,(H3,27,28)(H,31,32)(H,34,35)/t19-,20-/m0/s1 |
| InChIKey | PDOBANDWMALNEQ-PMACEKPBSA-N |
| XLogP | 1.54 |
| TPSA | 187.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|