C24H27N3O3S — CID 54539852
(3R)-4-(1-benzothiophen-3-yl)-3-[5-(4-carbamimidoylphenyl)pentanoylamino]butanoic acid (PubChem CID 54539852) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is (3R)-4-(1-benzothiophen-3-yl)-3-[5-(4-carbamimidoylphenyl)pentanoylamino]butanoic acid.
| Compound Name | (3R)-4-(1-benzothiophen-3-yl)-3-[5-(4-carbamimidoylphenyl)pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 54539852 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (3R)-4-(1-benzothiophen-3-yl)-3-[5-(4-carbamimidoylphenyl)pentanoylamino]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCCCC(=O)N[C@@H](CC(=O)O)Cc2csc3ccccc23)cc1 |
| InChI | InChI=1S/C24H27N3O3S/c25-24(26)17-11-9-16(10-12-17)5-1-4-8-22(28)27-19(14-23(29)30)13-18-15-31-21-7-3-2-6-20(18)21/h2-3,6-7,9-12,15,19H,1,4-5,8,13-14H2,(H3,25,26)(H,27,28)(H,29,30)/t19-/m1/s1 |
| InChIKey | ZCJPWLCWYVDQEV-LJQANCHMSA-N |
| XLogP | 4.10 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|