C21H29N3O3 — CID 57282907
3-[5-(4-carbamimidoylphenyl)pentanoylamino]-3-(cyclohexen-1-yl)propanoic acid (PubChem CID 57282907) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-[5-(4-carbamimidoylphenyl)pentanoylamino]-3-(cyclohexen-1-yl)propanoic acid.
| Compound Name | 3-[5-(4-carbamimidoylphenyl)pentanoylamino]-3-(cyclohexen-1-yl)propanoic acid |
|---|---|
| PubChem CID | 57282907 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 3-[5-(4-carbamimidoylphenyl)pentanoylamino]-3-(cyclohexen-1-yl)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCCCC(=O)NC(CC(=O)O)C2=CCCCC2)cc1 |
| InChI | InChI=1S/C21H29N3O3/c22-21(23)17-12-10-15(11-13-17)6-4-5-9-19(25)24-18(14-20(26)27)16-7-2-1-3-8-16/h7,10-13,18H,1-6,8-9,14H2,(H3,22,23)(H,24,25)(H,26,27) |
| InChIKey | NQKFEDLARBMLIG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|