C23H29N3O5S — CID 19431773
3-[5-(4-carbamimidoylphenyl)pentanoylamino]-4-(4-methylphenyl)sulfonylbutanoic acid (PubChem CID 19431773) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is 3-[5-(4-carbamimidoylphenyl)pentanoylamino]-4-(4-methylphenyl)sulfonylbutanoic acid.
| Compound Name | 3-[5-(4-carbamimidoylphenyl)pentanoylamino]-4-(4-methylphenyl)sulfonylbutanoic acid |
|---|---|
| PubChem CID | 19431773 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-[5-(4-carbamimidoylphenyl)pentanoylamino]-4-(4-methylphenyl)sulfonylbutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCCCC(=O)NC(CC(=O)O)CS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H29N3O5S/c1-16-6-12-20(13-7-16)32(30,31)15-19(14-22(28)29)26-21(27)5-3-2-4-17-8-10-18(11-9-17)23(24)25/h6-13,19H,2-5,14-15H2,1H3,(H3,24,25)(H,26,27)(H,28,29) |
| InChIKey | CDZXHJKCALJUBG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 150.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|