C24H33IN4O6S — CID 67661110
ethyl (2S)-3-[5-(4-carbamimidoylphenyl)pentanoylamino]-2-[(4-methoxyphenyl)sulfonylamino]propanoate;hydroiodide (PubChem CID 67661110) has the molecular formula C24H33IN4O6S and a molecular weight of 632.52 g/mol. Its IUPAC name is ethyl (2S)-3-[5-(4-carbamimidoylphenyl)pentanoylamino]-2-[(4-methoxyphenyl)sulfonylamino]propanoate;hydroiodide.
| Compound Name | ethyl (2S)-3-[5-(4-carbamimidoylphenyl)pentanoylamino]-2-[(4-methoxyphenyl)sulfonylamino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 67661110 |
| Molecular Formula | C24H33IN4O6S |
| Molecular Weight | 632.52 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | ethyl (2S)-3-[5-(4-carbamimidoylphenyl)pentanoylamino]-2-[(4-methoxyphenyl)sulfonylamino]propanoate;hydroiodide |
| SMILES | I.[H]/N=C(\N)c1ccc(CCCCC(=O)NC[C@H](NS(=O)(=O)c2ccc(OC)cc2)C(=O)OCC)cc1 |
| InChI | InChI=1S/C24H32N4O6S.HI/c1-3-34-24(30)21(28-35(31,32)20-14-12-19(33-2)13-15-20)16-27-22(29)7-5-4-6-17-8-10-18(11-9-17)23(25)26;/h8-15,21,28H,3-7,16H2,1-2H3,(H3,25,26)(H,27,29);1H/t21-;/m0./s1 |
| InChIKey | DHYBIIWNMGRJCE-BOXHHOBZSA-N |
| XLogP | 2.34 |
| TPSA | 160.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|