C28H37N5O8S — CID 57080925
[(2S)-3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]-2-[(4-ethylphenyl)sulfonylamino]propanoyl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 57080925) has the molecular formula C28H37N5O8S and a molecular weight of 603.70 g/mol. Its IUPAC name is [(2S)-3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]-2-[(4-ethylphenyl)sulfonylamino]propanoyl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(2S)-3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]-2-[(4-ethylphenyl)sulfonylamino]propanoyl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 57080925 |
| Molecular Formula | C28H37N5O8S |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | [(2S)-3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]-2-[(4-ethylphenyl)sulfonylamino]propanoyl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCCC(=O)NC[C@H](NS(=O)(=O)c2ccc(CC)cc2)C(=O)OCOC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H37N5O8S/c1-5-18-6-12-21(13-7-18)42(38,39)33-22(26(36)40-17-41-27(37)28(2,3)4)16-32-23(34)14-15-31-25(35)20-10-8-19(9-11-20)24(29)30/h6-13,22,33H,5,14-17H2,1-4H3,(H3,29,30)(H,31,35)(H,32,34)/t22-/m0/s1 |
| InChIKey | KXUFFKCRPWFPGC-QFIPXVFZSA-N |
| XLogP | 1.21 |
| TPSA | 206.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|