C21H25N5O6S — CID 57118342
(2S)-3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]-2-[(3-methylphenyl)sulfonylamino]propanoic acid (PubChem CID 57118342) has the molecular formula C21H25N5O6S and a molecular weight of 475.53 g/mol. Its IUPAC name is (2S)-3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]-2-[(3-methylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]-2-[(3-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 57118342 |
| Molecular Formula | C21H25N5O6S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (2S)-3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]-2-[(3-methylphenyl)sulfonylamino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCCC(=O)NC[C@H](NS(=O)(=O)c2cccc(C)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C21H25N5O6S/c1-13-3-2-4-16(11-13)33(31,32)26-17(21(29)30)12-25-18(27)9-10-24-20(28)15-7-5-14(6-8-15)19(22)23/h2-8,11,17,26H,9-10,12H2,1H3,(H3,22,23)(H,24,28)(H,25,27)(H,29,30)/t17-/m0/s1 |
| InChIKey | GYSXASMBXIDCKI-KRWDZBQOSA-N |
| XLogP | -0.05 |
| TPSA | 191.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|