C23H27N5O6S — CID 18794067
2-(benzenesulfonamido)-3-[[1-(4-carbamimidoylbenzoyl)piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 18794067) has the molecular formula C23H27N5O6S and a molecular weight of 501.57 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-3-[[1-(4-carbamimidoylbenzoyl)piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | 2-(benzenesulfonamido)-3-[[1-(4-carbamimidoylbenzoyl)piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18794067 |
| Molecular Formula | C23H27N5O6S |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 2-(benzenesulfonamido)-3-[[1-(4-carbamimidoylbenzoyl)piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N2CCCC(C(=O)NCC(NS(=O)(=O)c3ccccc3)C(=O)O)C2)cc1 |
| InChI | InChI=1S/C23H27N5O6S/c24-20(25)15-8-10-16(11-9-15)22(30)28-12-4-5-17(14-28)21(29)26-13-19(23(31)32)27-35(33,34)18-6-2-1-3-7-18/h1-3,6-11,17,19,27H,4-5,12-14H2,(H3,24,25)(H,26,29)(H,31,32) |
| InChIKey | YIVDNBRSASBFED-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 182.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|