C27H32F3N5O9S — CID 67563031
methyl (2S)-3-[[2-[(4S,6R)-4-(4-carbamimidoylphenyl)-3-methyl-2-oxo-1,3-oxazinan-6-yl]acetyl]amino]-2-[(3-methylphenyl)sulfonylamino]propanoate;2,2,2-trifluoroacetic acid (PubChem CID 67563031) has the molecular formula C27H32F3N5O9S and a molecular weight of 659.64 g/mol. Its IUPAC name is methyl (2S)-3-[[2-[(4S,6R)-4-(4-carbamimidoylphenyl)-3-methyl-2-oxo-1,3-oxazinan-6-yl]acetyl]amino]-2-[(3-methylphenyl)sulfonylamino]propanoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (2S)-3-[[2-[(4S,6R)-4-(4-carbamimidoylphenyl)-3-methyl-2-oxo-1,3-oxazinan-6-yl]acetyl]amino]-2-[(3-methylphenyl)sulfonylamino]propanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67563031 |
| Molecular Formula | C27H32F3N5O9S |
| Molecular Weight | 659.64 g/mol |
| Exact Mass | 659.19 |
| IUPAC Name | methyl (2S)-3-[[2-[(4S,6R)-4-(4-carbamimidoylphenyl)-3-methyl-2-oxo-1,3-oxazinan-6-yl]acetyl]amino]-2-[(3-methylphenyl)sulfonylamino]propanoate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc([C@@H]2C[C@H](CC(=O)NC[C@H](NS(=O)(=O)c3cccc(C)c3)C(=O)OC)OC(=O)N2C)cc1 |
| InChI | InChI=1S/C25H31N5O7S.C2HF3O2/c1-15-5-4-6-19(11-15)38(34,35)29-20(24(32)36-3)14-28-22(31)13-18-12-21(30(2)25(33)37-18)16-7-9-17(10-8-16)23(26)27;3-2(4,5)1(6)7/h4-11,18,20-21,29H,12-14H2,1-3H3,(H3,26,27)(H,28,31);(H,6,7)/t18-,20+,21+;/m1./s1 |
| InChIKey | LHQFDMFCTWALID-YAFGAGFVSA-N |
| XLogP | 1.82 |
| TPSA | 218.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.64 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|