C29H31F6N5O9S — CID 160657482
3-[3-(4-carbamimidoylphenyl)-1-oxo-2,8-diazaspiro[4.5]dec-2-en-8-yl]-2-[(3-methylphenyl)sulfonylamino]propanoic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 160657482) has the molecular formula C29H31F6N5O9S and a molecular weight of 739.65 g/mol. Its IUPAC name is 3-[3-(4-carbamimidoylphenyl)-1-oxo-2,8-diazaspiro[4.5]dec-2-en-8-yl]-2-[(3-methylphenyl)sulfonylamino]propanoic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-[3-(4-carbamimidoylphenyl)-1-oxo-2,8-diazaspiro[4.5]dec-2-en-8-yl]-2-[(3-methylphenyl)sulfonylamino]propanoic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 160657482 |
| Molecular Formula | C29H31F6N5O9S |
| Molecular Weight | 739.65 g/mol |
| Exact Mass | 739.17 |
| IUPAC Name | 3-[3-(4-carbamimidoylphenyl)-1-oxo-2,8-diazaspiro[4.5]dec-2-en-8-yl]-2-[(3-methylphenyl)sulfonylamino]propanoic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(C2=NC(=O)C3(CCN(CC(NS(=O)(=O)c4cccc(C)c4)C(=O)O)CC3)C2)cc1 |
| InChI | InChI=1S/C25H29N5O5S.2C2HF3O2/c1-16-3-2-4-19(13-16)36(34,35)29-21(23(31)32)15-30-11-9-25(10-12-30)14-20(28-24(25)33)17-5-7-18(8-6-17)22(26)27;2*3-2(4,5)1(6)7/h2-8,13,21,29H,9-12,14-15H2,1H3,(H3,26,27)(H,31,32);2*(H,6,7) |
| InChIKey | RLFUOSGBTDBYJZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 240.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.65 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|