C17H23F3N4O5S — CID 71476910
2-[(3-carbamimidoylphenyl)sulfonylamino]-N-cyclohexylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 71476910) has the molecular formula C17H23F3N4O5S and a molecular weight of 452.46 g/mol. Its IUPAC name is 2-[(3-carbamimidoylphenyl)sulfonylamino]-N-cyclohexylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3-carbamimidoylphenyl)sulfonylamino]-N-cyclohexylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71476910 |
| Molecular Formula | C17H23F3N4O5S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2-[(3-carbamimidoylphenyl)sulfonylamino]-N-cyclohexylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(S(=O)(=O)NCC(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C15H22N4O3S.C2HF3O2/c16-15(17)11-5-4-8-13(9-11)23(21,22)18-10-14(20)19-12-6-2-1-3-7-12;3-2(4,5)1(6)7/h4-5,8-9,12,18H,1-3,6-7,10H2,(H3,16,17)(H,19,20);(H,6,7) |
| InChIKey | HZJABQXHHMYKHA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 162.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|