C25H25F3N4O5S — CID 67366591
3-[[(3S)-3-[(naphthalen-2-ylsulfonylamino)methyl]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 67366591) has the molecular formula C25H25F3N4O5S and a molecular weight of 550.56 g/mol. Its IUPAC name is 3-[[(3S)-3-[(naphthalen-2-ylsulfonylamino)methyl]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[(3S)-3-[(naphthalen-2-ylsulfonylamino)methyl]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67366591 |
| Molecular Formula | C25H25F3N4O5S |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 3-[[(3S)-3-[(naphthalen-2-ylsulfonylamino)methyl]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(CN2CC[C@@H](CNS(=O)(=O)c3ccc4ccccc4c3)C2=O)c1 |
| InChI | InChI=1S/C23H24N4O3S.C2HF3O2/c24-22(25)19-7-3-4-16(12-19)15-27-11-10-20(23(27)28)14-26-31(29,30)21-9-8-17-5-1-2-6-18(17)13-21;3-2(4,5)1(6)7/h1-9,12-13,20,26H,10-11,14-15H2,(H3,24,25);(H,6,7)/t20-;/m0./s1 |
| InChIKey | VEXVXIOGPAYZKE-BDQAORGHSA-N |
| XLogP | 3.08 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|