C26H25F3N4O6S — CID 67365693
3-[[(3S)-2-oxo-3-[(4-phenoxyphenyl)sulfonylamino]pyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 67365693) has the molecular formula C26H25F3N4O6S and a molecular weight of 578.57 g/mol. Its IUPAC name is 3-[[(3S)-2-oxo-3-[(4-phenoxyphenyl)sulfonylamino]pyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[(3S)-2-oxo-3-[(4-phenoxyphenyl)sulfonylamino]pyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67365693 |
| Molecular Formula | C26H25F3N4O6S |
| Molecular Weight | 578.57 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | 3-[[(3S)-2-oxo-3-[(4-phenoxyphenyl)sulfonylamino]pyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(CN2CC[C@H](NS(=O)(=O)c3ccc(Oc4ccccc4)cc3)C2=O)c1 |
| InChI | InChI=1S/C24H24N4O4S.C2HF3O2/c25-23(26)18-6-4-5-17(15-18)16-28-14-13-22(24(28)29)27-33(30,31)21-11-9-20(10-12-21)32-19-7-2-1-3-8-19;3-2(4,5)1(6)7/h1-12,15,22,27H,13-14,16H2,(H3,25,26);(H,6,7)/t22-;/m0./s1 |
| InChIKey | KKFVUNXAFGTLAI-FTBISJDPSA-N |
| XLogP | 3.48 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|