C21H20F3N5O6 — CID 18392249
N-[(3S)-1-[(3-carbamimidoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-3-nitrobenzamide;2,2,2-trifluoroacetic acid (PubChem CID 18392249) has the molecular formula C21H20F3N5O6 and a molecular weight of 495.41 g/mol. Its IUPAC name is N-[(3S)-1-[(3-carbamimidoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-3-nitrobenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3S)-1-[(3-carbamimidoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-3-nitrobenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18392249 |
| Molecular Formula | C21H20F3N5O6 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | N-[(3S)-1-[(3-carbamimidoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-3-nitrobenzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(CN2CC[C@H](NC(=O)c3cccc([N+](=O)[O-])c3)C2=O)c1 |
| InChI | InChI=1S/C19H19N5O4.C2HF3O2/c20-17(21)13-4-1-3-12(9-13)11-23-8-7-16(19(23)26)22-18(25)14-5-2-6-15(10-14)24(27)28;3-2(4,5)1(6)7/h1-6,9-10,16H,7-8,11H2,(H3,20,21)(H,22,25);(H,6,7)/t16-;/m0./s1 |
| InChIKey | BELIPOSXPKNUCN-NTISSMGPSA-N |
| XLogP | 2.04 |
| TPSA | 179.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|