C20H22N4O3S — CID 174379603
3-[[(3S)-3-[(2-ethenylphenyl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide (PubChem CID 174379603) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is 3-[[(3S)-3-[(2-ethenylphenyl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 3-[[(3S)-3-[(2-ethenylphenyl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 174379603 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-[[(3S)-3-[(2-ethenylphenyl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CN2CC[C@H](NS(=O)(=O)c3ccccc3C=C)C2=O)c1 |
| InChI | InChI=1S/C20H22N4O3S/c1-2-15-7-3-4-9-18(15)28(26,27)23-17-10-11-24(20(17)25)13-14-6-5-8-16(12-14)19(21)22/h2-9,12,17,23H,1,10-11,13H2,(H3,21,22)/t17-/m0/s1 |
| InChIKey | BPNAIJIFKMAGMU-KRWDZBQOSA-N |
| XLogP | 1.69 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|