C21H20ClN5O3S2 — CID 19351003
3-[[3-[(4-chloro-5-pyridin-3-ylthiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide (PubChem CID 19351003) has the molecular formula C21H20ClN5O3S2 and a molecular weight of 490.01 g/mol. Its IUPAC name is 3-[[3-[(4-chloro-5-pyridin-3-ylthiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 3-[[3-[(4-chloro-5-pyridin-3-ylthiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 19351003 |
| Molecular Formula | C21H20ClN5O3S2 |
| Molecular Weight | 490.01 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 3-[[3-[(4-chloro-5-pyridin-3-ylthiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CN2CCC(NS(=O)(=O)c3cc(Cl)c(-c4cccnc4)s3)C2=O)c1 |
| InChI | InChI=1S/C21H20ClN5O3S2/c22-16-10-18(31-19(16)15-5-2-7-25-11-15)32(29,30)26-17-6-8-27(21(17)28)12-13-3-1-4-14(9-13)20(23)24/h1-5,7,9-11,17,26H,6,8,12H2,(H3,23,24) |
| InChIKey | KSSXSNIAHOCPMI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 129.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.01 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|