C19H20N6O3S2 — CID 22883597
4-amino-3-[[(3S)-2-oxo-3-(thieno[3,2-b]pyridin-2-ylsulfonylamino)pyrrolidin-1-yl]methyl]benzenecarboximidamide (PubChem CID 22883597) has the molecular formula C19H20N6O3S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 4-amino-3-[[(3S)-2-oxo-3-(thieno[3,2-b]pyridin-2-ylsulfonylamino)pyrrolidin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-amino-3-[[(3S)-2-oxo-3-(thieno[3,2-b]pyridin-2-ylsulfonylamino)pyrrolidin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 22883597 |
| Molecular Formula | C19H20N6O3S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 4-amino-3-[[(3S)-2-oxo-3-(thieno[3,2-b]pyridin-2-ylsulfonylamino)pyrrolidin-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N)c(CN2CC[C@H](NS(=O)(=O)c3cc4ncccc4s3)C2=O)c1 |
| InChI | InChI=1S/C19H20N6O3S2/c20-13-4-3-11(18(21)22)8-12(13)10-25-7-5-14(19(25)26)24-30(27,28)17-9-15-16(29-17)2-1-6-23-15/h1-4,6,8-9,14,24H,5,7,10,20H2,(H3,21,22)/t14-/m0/s1 |
| InChIKey | STWPJXHRWBUXOC-AWEZNQCLSA-N |
| XLogP | 1.24 |
| TPSA | 155.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|