C20H19ClN4O4S3 — CID 139831102
3-[[(3S)-3-[[5-(5-chlorothiophen-2-yl)thiophen-2-yl]sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]-4-hydroxybenzenecarboximidamide (PubChem CID 139831102) has the molecular formula C20H19ClN4O4S3 and a molecular weight of 511.05 g/mol. Its IUPAC name is 3-[[(3S)-3-[[5-(5-chlorothiophen-2-yl)thiophen-2-yl]sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]-4-hydroxybenzenecarboximidamide.
| Compound Name | 3-[[(3S)-3-[[5-(5-chlorothiophen-2-yl)thiophen-2-yl]sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]-4-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 139831102 |
| Molecular Formula | C20H19ClN4O4S3 |
| Molecular Weight | 511.05 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | 3-[[(3S)-3-[[5-(5-chlorothiophen-2-yl)thiophen-2-yl]sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]-4-hydroxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(O)c(CN2CC[C@H](NS(=O)(=O)c3ccc(-c4ccc(Cl)s4)s3)C2=O)c1 |
| InChI | InChI=1S/C20H19ClN4O4S3/c21-17-5-3-15(30-17)16-4-6-18(31-16)32(28,29)24-13-7-8-25(20(13)27)10-12-9-11(19(22)23)1-2-14(12)26/h1-6,9,13,24,26H,7-8,10H2,(H3,22,23)/t13-/m0/s1 |
| InChIKey | OVHIRBLCDWVBBC-ZDUSSCGKSA-N |
| XLogP | 3.20 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.05 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|