C20H15Cl2N3O4S2 — CID 54067569
4,6-dichloro-N-[1-[(5-cyano-2-hydroxyphenyl)methyl]-2-oxopyrrolidin-3-yl]-1-benzothiophene-2-sulfonamide (PubChem CID 54067569) has the molecular formula C20H15Cl2N3O4S2 and a molecular weight of 496.40 g/mol. Its IUPAC name is 4,6-dichloro-N-[1-[(5-cyano-2-hydroxyphenyl)methyl]-2-oxopyrrolidin-3-yl]-1-benzothiophene-2-sulfonamide.
| Compound Name | 4,6-dichloro-N-[1-[(5-cyano-2-hydroxyphenyl)methyl]-2-oxopyrrolidin-3-yl]-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 54067569 |
| Molecular Formula | C20H15Cl2N3O4S2 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 494.99 |
| IUPAC Name | 4,6-dichloro-N-[1-[(5-cyano-2-hydroxyphenyl)methyl]-2-oxopyrrolidin-3-yl]-1-benzothiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(O)c(CN2CCC(NS(=O)(=O)c3cc4c(Cl)cc(Cl)cc4s3)C2=O)c1 |
| InChI | InChI=1S/C20H15Cl2N3O4S2/c21-13-6-15(22)14-8-19(30-18(14)7-13)31(28,29)24-16-3-4-25(20(16)27)10-12-5-11(9-23)1-2-17(12)26/h1-2,5-8,16,24,26H,3-4,10H2 |
| InChIKey | MECHXYHWYRUNKK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|