C19H16ClN5O3S2 — CID 54056382
N-[(3S)-1-[(2-amino-5-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-5-chlorothieno[3,2-b]pyridine-2-sulfonamide (PubChem CID 54056382) has the molecular formula C19H16ClN5O3S2 and a molecular weight of 461.96 g/mol. Its IUPAC name is N-[(3S)-1-[(2-amino-5-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-5-chlorothieno[3,2-b]pyridine-2-sulfonamide.
| Compound Name | N-[(3S)-1-[(2-amino-5-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-5-chlorothieno[3,2-b]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 54056382 |
| Molecular Formula | C19H16ClN5O3S2 |
| Molecular Weight | 461.96 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | N-[(3S)-1-[(2-amino-5-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-5-chlorothieno[3,2-b]pyridine-2-sulfonamide |
| SMILES | N#Cc1ccc(N)c(CN2CC[C@H](NS(=O)(=O)c3cc4nc(Cl)ccc4s3)C2=O)c1 |
| InChI | InChI=1S/C19H16ClN5O3S2/c20-17-4-3-16-15(23-17)8-18(29-16)30(27,28)24-14-5-6-25(19(14)26)10-12-7-11(9-21)1-2-13(12)22/h1-4,7-8,14,24H,5-6,10,22H2/t14-/m0/s1 |
| InChIKey | LWOFMEKHHPTRCA-AWEZNQCLSA-N |
| XLogP | 2.48 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.96 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|