C21H18Cl2N4O5S2 — CID 135985136
[3-[[(3S)-3-[(4,6-dichloro-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]phenyl]iminomethylcarbamic acid (PubChem CID 135985136) has the molecular formula C21H18Cl2N4O5S2 and a molecular weight of 541.44 g/mol. Its IUPAC name is [3-[[(3S)-3-[(4,6-dichloro-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]phenyl]iminomethylcarbamic acid.
| Compound Name | [3-[[(3S)-3-[(4,6-dichloro-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]phenyl]iminomethylcarbamic acid |
|---|---|
| PubChem CID | 135985136 |
| Molecular Formula | C21H18Cl2N4O5S2 |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 540.01 |
| IUPAC Name | [3-[[(3S)-3-[(4,6-dichloro-1-benzothiophen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]phenyl]iminomethylcarbamic acid |
| SMILES | O=C(O)N/C=N/c1cccc(CN2CC[C@H](NS(=O)(=O)c3cc4c(Cl)cc(Cl)cc4s3)C2=O)c1 |
| InChI | InChI=1S/C21H18Cl2N4O5S2/c22-13-7-16(23)15-9-19(33-18(15)8-13)34(31,32)26-17-4-5-27(20(17)28)10-12-2-1-3-14(6-12)24-11-25-21(29)30/h1-3,6-9,11,17,26H,4-5,10H2,(H,24,25)(H,29,30)/t17-/m0/s1 |
| InChIKey | GJEARRJVICAUAH-KRWDZBQOSA-N |
| XLogP | 4.21 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|