C21H21N5O3S2 — CID 67644411
2-[[2-oxo-3-[(5-pyridin-3-ylthiophen-2-yl)sulfonylamino]pyrrolidin-1-yl]methyl]benzenecarboximidamide (PubChem CID 67644411) has the molecular formula C21H21N5O3S2 and a molecular weight of 455.57 g/mol. Its IUPAC name is 2-[[2-oxo-3-[(5-pyridin-3-ylthiophen-2-yl)sulfonylamino]pyrrolidin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 2-[[2-oxo-3-[(5-pyridin-3-ylthiophen-2-yl)sulfonylamino]pyrrolidin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 67644411 |
| Molecular Formula | C21H21N5O3S2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-[[2-oxo-3-[(5-pyridin-3-ylthiophen-2-yl)sulfonylamino]pyrrolidin-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1CN1CCC(NS(=O)(=O)c2ccc(-c3cccnc3)s2)C1=O |
| InChI | InChI=1S/C21H21N5O3S2/c22-20(23)16-6-2-1-4-15(16)13-26-11-9-17(21(26)27)25-31(28,29)19-8-7-18(30-19)14-5-3-10-24-12-14/h1-8,10,12,17,25H,9,11,13H2,(H3,22,23) |
| InChIKey | SVDNZLMGMWPYBY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 129.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|