C21H22N4O3S2 — CID 22883581
3-[[(3S)-3-[1-benzothiophen-2-ylsulfonyl(methyl)amino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide (PubChem CID 22883581) has the molecular formula C21H22N4O3S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 3-[[(3S)-3-[1-benzothiophen-2-ylsulfonyl(methyl)amino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 3-[[(3S)-3-[1-benzothiophen-2-ylsulfonyl(methyl)amino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 22883581 |
| Molecular Formula | C21H22N4O3S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 3-[[(3S)-3-[1-benzothiophen-2-ylsulfonyl(methyl)amino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CN2CC[C@H](N(C)S(=O)(=O)c3cc4ccccc4s3)C2=O)c1 |
| InChI | InChI=1S/C21H22N4O3S2/c1-24(30(27,28)19-12-15-6-2-3-8-18(15)29-19)17-9-10-25(21(17)26)13-14-5-4-7-16(11-14)20(22)23/h2-8,11-12,17H,9-10,13H2,1H3,(H3,22,23)/t17-/m0/s1 |
| InChIKey | QWCGRQCYXMKVFB-KRWDZBQOSA-N |
| XLogP | 2.61 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|