C27H31N5O5S — CID 18392280
2-[[(3S)-1-[(3-carbamimidoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]-N,N-dimethylacetamide (PubChem CID 18392280) has the molecular formula C27H31N5O5S and a molecular weight of 537.64 g/mol. Its IUPAC name is 2-[[(3S)-1-[(3-carbamimidoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3S)-1-[(3-carbamimidoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 18392280 |
| Molecular Formula | C27H31N5O5S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 2-[[(3S)-1-[(3-carbamimidoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]-N,N-dimethylacetamide |
| SMILES | [H]/N=C(\N)c1cccc(CN2CC[C@H](N(CC(=O)N(C)C)S(=O)(=O)c3ccc4ccc(OC)cc4c3)C2=O)c1 |
| InChI | InChI=1S/C27H31N5O5S/c1-30(2)25(33)17-32(38(35,36)23-10-8-19-7-9-22(37-3)14-21(19)15-23)24-11-12-31(27(24)34)16-18-5-4-6-20(13-18)26(28)29/h4-10,13-15,24H,11-12,16-17H2,1-3H3,(H3,28,29)/t24-/m0/s1 |
| InChIKey | IAEVVFFUTFVAKT-DEOSSOPVSA-N |
| XLogP | 2.01 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|