C34H34F3N5O7S — CID 67367278
N-benzyl-2-[[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 67367278) has the molecular formula C34H34F3N5O7S and a molecular weight of 713.74 g/mol. Its IUPAC name is N-benzyl-2-[[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-benzyl-2-[[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67367278 |
| Molecular Formula | C34H34F3N5O7S |
| Molecular Weight | 713.74 g/mol |
| Exact Mass | 713.21 |
| IUPAC Name | N-benzyl-2-[[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc2ccc(S(=O)(=O)N(CC(=O)NCc3ccccc3)[C@H]3CCN(Cc4cccc(C=NN)c4)C3=O)cc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C32H33N5O5S.C2HF3O2/c1-42-28-12-10-26-11-13-29(18-27(26)17-28)43(40,41)37(22-31(38)34-19-23-6-3-2-4-7-23)30-14-15-36(32(30)39)21-25-9-5-8-24(16-25)20-35-33;3-2(4,5)1(6)7/h2-13,16-18,20,30H,14-15,19,21-22,33H2,1H3,(H,34,38);(H,6,7)/t30-;/m0./s1 |
| InChIKey | MRQFYDABMZCZLM-CZCBIWLKSA-N |
| XLogP | 3.88 |
| TPSA | 171.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.74 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|