C27H32N4O6S2 — CID 139802159
tert-butyl 2-[[(3S)-1-[(5-carbamimidoylthiophen-3-yl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]acetate (PubChem CID 139802159) has the molecular formula C27H32N4O6S2 and a molecular weight of 572.71 g/mol. Its IUPAC name is tert-butyl 2-[[(3S)-1-[(5-carbamimidoylthiophen-3-yl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]acetate.
| Compound Name | tert-butyl 2-[[(3S)-1-[(5-carbamimidoylthiophen-3-yl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 139802159 |
| Molecular Formula | C27H32N4O6S2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | tert-butyl 2-[[(3S)-1-[(5-carbamimidoylthiophen-3-yl)methyl]-2-oxopyrrolidin-3-yl]-(7-methoxynaphthalen-2-yl)sulfonylamino]acetate |
| SMILES | [H]/N=C(\N)c1cc(CN2CC[C@H](N(CC(=O)OC(C)(C)C)S(=O)(=O)c3ccc4ccc(OC)cc4c3)C2=O)cs1 |
| InChI | InChI=1S/C27H32N4O6S2/c1-27(2,3)37-24(32)15-31(22-9-10-30(26(22)33)14-17-11-23(25(28)29)38-16-17)39(34,35)21-8-6-18-5-7-20(36-4)12-19(18)13-21/h5-8,11-13,16,22H,9-10,14-15H2,1-4H3,(H3,28,29)/t22-/m0/s1 |
| InChIKey | OSDIOOKYTYCBIA-QFIPXVFZSA-N |
| XLogP | 3.33 |
| TPSA | 143.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|