C25H26N4O7S — CID 67365960
2-[4-methanehydrazonoyl-2-[[3-[(7-methoxynaphthalen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]phenoxy]acetic acid (PubChem CID 67365960) has the molecular formula C25H26N4O7S and a molecular weight of 526.57 g/mol. Its IUPAC name is 2-[4-methanehydrazonoyl-2-[[3-[(7-methoxynaphthalen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-methanehydrazonoyl-2-[[3-[(7-methoxynaphthalen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67365960 |
| Molecular Formula | C25H26N4O7S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | 2-[4-methanehydrazonoyl-2-[[3-[(7-methoxynaphthalen-2-yl)sulfonylamino]-2-oxopyrrolidin-1-yl]methyl]phenoxy]acetic acid |
| SMILES | COc1ccc2ccc(S(=O)(=O)NC3CCN(Cc4cc(C=NN)ccc4OCC(=O)O)C3=O)cc2c1 |
| InChI | InChI=1S/C25H26N4O7S/c1-35-20-5-3-17-4-6-21(12-18(17)11-20)37(33,34)28-22-8-9-29(25(22)32)14-19-10-16(13-27-26)2-7-23(19)36-15-24(30)31/h2-7,10-13,22,28H,8-9,14-15,26H2,1H3,(H,30,31) |
| InChIKey | SAJCIWGQUJZBFB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 160.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|