C24H27F3N4O5S — CID 161227686
N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 161227686) has the molecular formula C24H27F3N4O5S and a molecular weight of 540.56 g/mol. Its IUPAC name is N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161227686 |
| Molecular Formula | C24H27F3N4O5S |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | N-[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | NN=Cc1cccc(CN2CC[C@H](NS(=O)(=O)c3ccc4c(c3)CCCC4)C2=O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H26N4O3S.C2HF3O2/c23-24-14-16-4-3-5-17(12-16)15-26-11-10-21(22(26)27)25-30(28,29)20-9-8-18-6-1-2-7-19(18)13-20;3-2(4,5)1(6)7/h3-5,8-9,12-14,21,25H,1-2,6-7,10-11,15,23H2;(H,6,7)/t21-;/m0./s1 |
| InChIKey | UYILOPMDMLMLGB-BOXHHOBZSA-N |
| XLogP | 2.57 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|