C34H35N5O4S — CID 67365432
2-[[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-(4-phenylphenyl)sulfonylamino]-N-(2-phenylethyl)acetamide (PubChem CID 67365432) has the molecular formula C34H35N5O4S and a molecular weight of 609.75 g/mol. Its IUPAC name is 2-[[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-(4-phenylphenyl)sulfonylamino]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-(4-phenylphenyl)sulfonylamino]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 67365432 |
| Molecular Formula | C34H35N5O4S |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | 2-[[(3S)-1-[(3-methanehydrazonoylphenyl)methyl]-2-oxopyrrolidin-3-yl]-(4-phenylphenyl)sulfonylamino]-N-(2-phenylethyl)acetamide |
| SMILES | NN=Cc1cccc(CN2CC[C@H](N(CC(=O)NCCc3ccccc3)S(=O)(=O)c3ccc(-c4ccccc4)cc3)C2=O)c1 |
| InChI | InChI=1S/C34H35N5O4S/c35-37-23-27-10-7-11-28(22-27)24-38-21-19-32(34(38)41)39(25-33(40)36-20-18-26-8-3-1-4-9-26)44(42,43)31-16-14-30(15-17-31)29-12-5-2-6-13-29/h1-17,22-23,32H,18-21,24-25,35H2,(H,36,40)/t32-/m0/s1 |
| InChIKey | HYUDNGOVQNCPFN-YTTGMZPUSA-N |
| XLogP | 3.80 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|