C17H26N6O6S — CID 10203754
(2S)-2-(benzenesulfonamido)-3-[3-[4-(diaminomethylideneamino)butanoylamino]propanoylamino]propanoic acid (PubChem CID 10203754) has the molecular formula C17H26N6O6S and a molecular weight of 442.50 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-3-[3-[4-(diaminomethylideneamino)butanoylamino]propanoylamino]propanoic acid.
| Compound Name | (2S)-2-(benzenesulfonamido)-3-[3-[4-(diaminomethylideneamino)butanoylamino]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 10203754 |
| Molecular Formula | C17H26N6O6S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-3-[3-[4-(diaminomethylideneamino)butanoylamino]propanoylamino]propanoic acid |
| SMILES | NC(N)=NCCCC(=O)NCCC(=O)NC[C@H](NS(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H26N6O6S/c18-17(19)21-9-4-7-14(24)20-10-8-15(25)22-11-13(16(26)27)23-30(28,29)12-5-2-1-3-6-12/h1-3,5-6,13,23H,4,7-11H2,(H,20,24)(H,22,25)(H,26,27)(H4,18,19,21)/t13-/m0/s1 |
| InChIKey | ZRYJRQJHPCPRDH-ZDUSSCGKSA-N |
| XLogP | -1.91 |
| TPSA | 206.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|