C17H20N4O7S — CID 23398260
3-[[5-(2-aminoethylcarbamoyl)furan-2-carbonyl]amino]-2-(benzenesulfonamido)propanoic acid (PubChem CID 23398260) has the molecular formula C17H20N4O7S and a molecular weight of 424.44 g/mol. Its IUPAC name is 3-[[5-(2-aminoethylcarbamoyl)furan-2-carbonyl]amino]-2-(benzenesulfonamido)propanoic acid.
| Compound Name | 3-[[5-(2-aminoethylcarbamoyl)furan-2-carbonyl]amino]-2-(benzenesulfonamido)propanoic acid |
|---|---|
| PubChem CID | 23398260 |
| Molecular Formula | C17H20N4O7S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 3-[[5-(2-aminoethylcarbamoyl)furan-2-carbonyl]amino]-2-(benzenesulfonamido)propanoic acid |
| SMILES | NCCNC(=O)c1ccc(C(=O)NCC(NS(=O)(=O)c2ccccc2)C(=O)O)o1 |
| InChI | InChI=1S/C17H20N4O7S/c18-8-9-19-15(22)13-6-7-14(28-13)16(23)20-10-12(17(24)25)21-29(26,27)11-4-2-1-3-5-11/h1-7,12,21H,8-10,18H2,(H,19,22)(H,20,23)(H,24,25) |
| InChIKey | ANDNHIWZZMSZPS-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 180.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |