C21H23N5O6S — CID 67649728
3-(pyridin-2-ylamino)propyl 2-(benzenesulfonamido)-3-(1,2-oxazole-5-carbonylamino)propanoate (PubChem CID 67649728) has the molecular formula C21H23N5O6S and a molecular weight of 473.51 g/mol. Its IUPAC name is 3-(pyridin-2-ylamino)propyl 2-(benzenesulfonamido)-3-(1,2-oxazole-5-carbonylamino)propanoate.
| Compound Name | 3-(pyridin-2-ylamino)propyl 2-(benzenesulfonamido)-3-(1,2-oxazole-5-carbonylamino)propanoate |
|---|---|
| PubChem CID | 67649728 |
| Molecular Formula | C21H23N5O6S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 3-(pyridin-2-ylamino)propyl 2-(benzenesulfonamido)-3-(1,2-oxazole-5-carbonylamino)propanoate |
| SMILES | O=C(NCC(NS(=O)(=O)c1ccccc1)C(=O)OCCCNc1ccccn1)c1ccno1 |
| InChI | InChI=1S/C21H23N5O6S/c27-20(18-10-13-25-32-18)24-15-17(26-33(29,30)16-7-2-1-3-8-16)21(28)31-14-6-12-23-19-9-4-5-11-22-19/h1-5,7-11,13,17,26H,6,12,14-15H2,(H,22,23)(H,24,27) |
| InChIKey | IDZYVKWMOSGUFE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|